C19H24N2O3 — CID 156879532
6-methanimidoyl-4-methyl-7-(oxan-2-ylamino)-3-propan-2-ylisochromen-1-one (PubChem CID 156879532) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 6-methanimidoyl-4-methyl-7-(oxan-2-ylamino)-3-propan-2-ylisochromen-1-one.
| Compound Name | 6-methanimidoyl-4-methyl-7-(oxan-2-ylamino)-3-propan-2-ylisochromen-1-one |
|---|---|
| PubChem CID | 156879532 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 6-methanimidoyl-4-methyl-7-(oxan-2-ylamino)-3-propan-2-ylisochromen-1-one |
| SMILES | [H]/N=C/c1cc2c(C)c(C(C)C)oc(=O)c2cc1NC1CCCCO1 |
| InChI | InChI=1S/C19H24N2O3/c1-11(2)18-12(3)14-8-13(10-20)16(9-15(14)19(22)24-18)21-17-6-4-5-7-23-17/h8-11,17,20-21H,4-7H2,1-3H3/b20-10+ |
| InChIKey | DGFOTOGVHREYAJ-KEBDBYFISA-N |
| XLogP | 4.16 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|