C13H19ClN4O3 — CID 62869428
4-[4-chloro-6-(oxan-2-ylmethoxy)-1,3,5-triazin-2-yl]morpholine (PubChem CID 62869428) has the molecular formula C13H19ClN4O3 and a molecular weight of 314.77 g/mol. Its IUPAC name is 4-[4-chloro-6-(oxan-2-ylmethoxy)-1,3,5-triazin-2-yl]morpholine.
| Compound Name | 4-[4-chloro-6-(oxan-2-ylmethoxy)-1,3,5-triazin-2-yl]morpholine |
|---|---|
| PubChem CID | 62869428 |
| Molecular Formula | C13H19ClN4O3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-[4-chloro-6-(oxan-2-ylmethoxy)-1,3,5-triazin-2-yl]morpholine |
| SMILES | Clc1nc(OCC2CCCCO2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H19ClN4O3/c14-11-15-12(18-4-7-19-8-5-18)17-13(16-11)21-9-10-3-1-2-6-20-10/h10H,1-9H2 |
| InChIKey | LYWVLSGDZKZIJI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |