C12H17ClN4O3 — CID 62869818
4-[4-chloro-6-(oxan-4-yloxy)-1,3,5-triazin-2-yl]morpholine (PubChem CID 62869818) has the molecular formula C12H17ClN4O3 and a molecular weight of 300.75 g/mol. Its IUPAC name is 4-[4-chloro-6-(oxan-4-yloxy)-1,3,5-triazin-2-yl]morpholine.
| Compound Name | 4-[4-chloro-6-(oxan-4-yloxy)-1,3,5-triazin-2-yl]morpholine |
|---|---|
| PubChem CID | 62869818 |
| Molecular Formula | C12H17ClN4O3 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-[4-chloro-6-(oxan-4-yloxy)-1,3,5-triazin-2-yl]morpholine |
| SMILES | Clc1nc(OC2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H17ClN4O3/c13-10-14-11(17-3-7-19-8-4-17)16-12(15-10)20-9-1-5-18-6-2-9/h9H,1-8H2 |
| InChIKey | RNNOHYQPFWRDLC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |