C12H15Cl4N7O3 — CID 173009515
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholine;2,4,6-trichloro-1,3,5-triazine;hydrochloride (PubChem CID 173009515) has the molecular formula C12H15Cl4N7O3 and a molecular weight of 447.11 g/mol. Its IUPAC name is 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholine;2,4,6-trichloro-1,3,5-triazine;hydrochloride.
| Compound Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholine;2,4,6-trichloro-1,3,5-triazine;hydrochloride |
|---|---|
| PubChem CID | 173009515 |
| Molecular Formula | C12H15Cl4N7O3 |
| Molecular Weight | 447.11 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholine;2,4,6-trichloro-1,3,5-triazine;hydrochloride |
| SMILES | COc1nc(OC)nc(N2CCOCC2)n1.Cl.Clc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H14N4O3.C3Cl3N3.ClH/c1-14-8-10-7(11-9(12-8)15-2)13-3-5-16-6-4-13;4-1-7-2(5)9-3(6)8-1;/h3-6H2,1-2H3;;1H |
| InChIKey | YALNYFXSHKIADN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 108.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.11 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |