C8H11N7O2 — CID 4550609
4-(4-azido-6-methoxy-1,3,5-triazin-2-yl)morpholine (PubChem CID 4550609) has the molecular formula C8H11N7O2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 4-(4-azido-6-methoxy-1,3,5-triazin-2-yl)morpholine.
| Compound Name | 4-(4-azido-6-methoxy-1,3,5-triazin-2-yl)morpholine |
|---|---|
| PubChem CID | 4550609 |
| Molecular Formula | C8H11N7O2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 4-(4-azido-6-methoxy-1,3,5-triazin-2-yl)morpholine |
| SMILES | COc1nc(N=[N+]=[N-])nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C8H11N7O2/c1-16-8-11-6(13-14-9)10-7(12-8)15-2-4-17-5-3-15/h2-5H2,1H3 |
| InChIKey | XUQVJYMCHVNIEG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 109.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|