C9H13N7O — CID 557838
2-azido-4-methoxy-6-piperidin-1-yl-1,3,5-triazine (PubChem CID 557838) has the molecular formula C9H13N7O and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-azido-4-methoxy-6-piperidin-1-yl-1,3,5-triazine.
| Compound Name | 2-azido-4-methoxy-6-piperidin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 557838 |
| Molecular Formula | C9H13N7O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-azido-4-methoxy-6-piperidin-1-yl-1,3,5-triazine |
| SMILES | COc1nc(N=[N+]=[N-])nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C9H13N7O/c1-17-9-12-7(14-15-10)11-8(13-9)16-5-3-2-4-6-16/h2-6H2,1H3 |
| InChIKey | VFSGQLBIHSCQRJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 99.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|