C8H11IN4O — CID 143257916
2-iodo-4-methoxy-6-pyrrolidin-1-yl-1,3,5-triazine (PubChem CID 143257916) has the molecular formula C8H11IN4O and a molecular weight of 306.11 g/mol. Its IUPAC name is 2-iodo-4-methoxy-6-pyrrolidin-1-yl-1,3,5-triazine.
| Compound Name | 2-iodo-4-methoxy-6-pyrrolidin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 143257916 |
| Molecular Formula | C8H11IN4O |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-iodo-4-methoxy-6-pyrrolidin-1-yl-1,3,5-triazine |
| SMILES | COc1nc(I)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C8H11IN4O/c1-14-8-11-6(9)10-7(12-8)13-4-2-3-5-13/h2-5H2,1H3 |
| InChIKey | ZGSBTNXDVYDDCS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|