C10H13N7O3 — CID 13416497
ethyl 4-azido-6-morpholin-4-yl-1,3,5-triazine-2-carboxylate (PubChem CID 13416497) has the molecular formula C10H13N7O3 and a molecular weight of 279.26 g/mol. Its IUPAC name is ethyl 4-azido-6-morpholin-4-yl-1,3,5-triazine-2-carboxylate.
| Compound Name | ethyl 4-azido-6-morpholin-4-yl-1,3,5-triazine-2-carboxylate |
|---|---|
| PubChem CID | 13416497 |
| Molecular Formula | C10H13N7O3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | ethyl 4-azido-6-morpholin-4-yl-1,3,5-triazine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(N=[N+]=[N-])nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C10H13N7O3/c1-2-20-8(18)7-12-9(15-16-11)14-10(13-7)17-3-5-19-6-4-17/h2-6H2,1H3 |
| InChIKey | LTNZCBATCWFAKY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 126.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|