C22H33ClN8O2 — CID 150914174
4-[2-chloro-9-(oxan-2-yl)-8-[(3-piperazin-1-ylazetidin-1-yl)methyl]purin-6-yl]morpholine (PubChem CID 150914174) has the molecular formula C22H33ClN8O2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 4-[2-chloro-9-(oxan-2-yl)-8-[(3-piperazin-1-ylazetidin-1-yl)methyl]purin-6-yl]morpholine.
| Compound Name | 4-[2-chloro-9-(oxan-2-yl)-8-[(3-piperazin-1-ylazetidin-1-yl)methyl]purin-6-yl]morpholine |
|---|---|
| PubChem CID | 150914174 |
| Molecular Formula | C22H33ClN8O2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 4-[2-chloro-9-(oxan-2-yl)-8-[(3-piperazin-1-ylazetidin-1-yl)methyl]purin-6-yl]morpholine |
| SMILES | Clc1nc(N2CCOCC2)c2nc(CN3CC(N4CCNCC4)C3)n(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C22H33ClN8O2/c23-22-26-20(30-8-11-32-12-9-30)19-21(27-22)31(18-3-1-2-10-33-18)17(25-19)15-28-13-16(14-28)29-6-4-24-5-7-29/h16,18,24H,1-15H2 |
| InChIKey | LCPXZVGLGOURQM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |