C30H31NO3 — CID 129079956
3-(3-hydroxyphenyl)-4-methyl-2-[4-[(E)-3-[(3R)-3-methylpyrrolidin-1-yl]prop-1-enyl]phenyl]-2H-chromen-6-ol (PubChem CID 129079956) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-4-methyl-2-[4-[(E)-3-[(3R)-3-methylpyrrolidin-1-yl]prop-1-enyl]phenyl]-2H-chromen-6-ol.
| Compound Name | 3-(3-hydroxyphenyl)-4-methyl-2-[4-[(E)-3-[(3R)-3-methylpyrrolidin-1-yl]prop-1-enyl]phenyl]-2H-chromen-6-ol |
|---|---|
| PubChem CID | 129079956 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 3-(3-hydroxyphenyl)-4-methyl-2-[4-[(E)-3-[(3R)-3-methylpyrrolidin-1-yl]prop-1-enyl]phenyl]-2H-chromen-6-ol |
| SMILES | CC1=C(c2cccc(O)c2)C(c2ccc(/C=C/CN3CC[C@@H](C)C3)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C30H31NO3/c1-20-14-16-31(19-20)15-4-5-22-8-10-23(11-9-22)30-29(24-6-3-7-25(32)17-24)21(2)27-18-26(33)12-13-28(27)34-30/h3-13,17-18,20,30,32-33H,14-16,19H2,1-2H3/b5-4+/t20-,30?/m1/s1 |
| InChIKey | DAXWFUDFXUDPJB-JVRJJBFHSA-N |
| XLogP | 6.52 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|