C30H34FNO10S2 — CID 87054999
ethane-1,2-disulfonic acid;2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 87054999) has the molecular formula C30H34FNO10S2 and a molecular weight of 651.73 g/mol. Its IUPAC name is ethane-1,2-disulfonic acid;2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | ethane-1,2-disulfonic acid;2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 87054999 |
| Molecular Formula | C30H34FNO10S2 |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | ethane-1,2-disulfonic acid;2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2cccc(O)c2)C(c2ccc(OCCN3CC(CF)C3)cc2)Oc2ccc(O)cc21.O=S(=O)(O)CCS(=O)(=O)O |
| InChI | InChI=1S/C28H28FNO4.C2H6O6S2/c1-18-25-14-23(32)7-10-26(25)34-28(27(18)21-3-2-4-22(31)13-21)20-5-8-24(9-6-20)33-12-11-30-16-19(15-29)17-30;3-9(4,5)1-2-10(6,7)8/h2-10,13-14,19,28,31-32H,11-12,15-17H2,1H3;1-2H2,(H,3,4,5)(H,6,7,8) |
| InChIKey | DJSYTNWPYJAMOH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|