C35H34FNO6 — CID 87055832
benzoic acid;(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 87055832) has the molecular formula C35H34FNO6 and a molecular weight of 583.66 g/mol. Its IUPAC name is benzoic acid;(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | benzoic acid;(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 87055832 |
| Molecular Formula | C35H34FNO6 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | benzoic acid;(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2cccc(O)c2)[C@@H](c2ccc(OCCN3CC(CF)C3)cc2)Oc2ccc(O)cc21.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C28H28FNO4.C7H6O2/c1-18-25-14-23(32)7-10-26(25)34-28(27(18)21-3-2-4-22(31)13-21)20-5-8-24(9-6-20)33-12-11-30-16-19(15-29)17-30;8-7(9)6-4-2-1-3-5-6/h2-10,13-14,19,28,31-32H,11-12,15-17H2,1H3;1-5H,(H,8,9)/t28-;/m1./s1 |
| InChIKey | ZLHBSLDXGVLHRL-LNLSOMNWSA-N |
| XLogP | 6.83 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|