C29H30FNO3 — CID 78132252
2-[4-[2-[3-(fluoromethyl)pyrrolidin-1-yl]ethoxy]phenyl]-4-methyl-3-phenyl-2H-chromen-6-ol (PubChem CID 78132252) has the molecular formula C29H30FNO3 and a molecular weight of 459.56 g/mol. Its IUPAC name is 2-[4-[2-[3-(fluoromethyl)pyrrolidin-1-yl]ethoxy]phenyl]-4-methyl-3-phenyl-2H-chromen-6-ol.
| Compound Name | 2-[4-[2-[3-(fluoromethyl)pyrrolidin-1-yl]ethoxy]phenyl]-4-methyl-3-phenyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 78132252 |
| Molecular Formula | C29H30FNO3 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-[4-[2-[3-(fluoromethyl)pyrrolidin-1-yl]ethoxy]phenyl]-4-methyl-3-phenyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2ccccc2)C(c2ccc(OCCN3CCC(CF)C3)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C29H30FNO3/c1-20-26-17-24(32)9-12-27(26)34-29(28(20)22-5-3-2-4-6-22)23-7-10-25(11-8-23)33-16-15-31-14-13-21(18-30)19-31/h2-12,17,21,29,32H,13-16,18-19H2,1H3 |
| InChIKey | QYHJXDXPKIQUQZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|