C29H28FNO5 — CID 121423245
4-[(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-hydroxy-4-methyl-2H-chromen-3-yl]benzoic acid (PubChem CID 121423245) has the molecular formula C29H28FNO5 and a molecular weight of 489.54 g/mol. Its IUPAC name is 4-[(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-hydroxy-4-methyl-2H-chromen-3-yl]benzoic acid.
| Compound Name | 4-[(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-hydroxy-4-methyl-2H-chromen-3-yl]benzoic acid |
|---|---|
| PubChem CID | 121423245 |
| Molecular Formula | C29H28FNO5 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 4-[(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-hydroxy-4-methyl-2H-chromen-3-yl]benzoic acid |
| SMILES | CC1=C(c2ccc(C(=O)O)cc2)[C@@H](c2ccc(OCCN3CC(CF)C3)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C29H28FNO5/c1-18-25-14-23(32)8-11-26(25)36-28(27(18)20-2-4-22(5-3-20)29(33)34)21-6-9-24(10-7-21)35-13-12-31-16-19(15-30)17-31/h2-11,14,19,28,32H,12-13,15-17H2,1H3,(H,33,34)/t28-/m1/s1 |
| InChIKey | HPQWCMGBQSNUBW-MUUNZHRXSA-N |
| XLogP | 5.43 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|