C36H36FNO6 — CID 87055172
2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol;2-phenylacetic acid (PubChem CID 87055172) has the molecular formula C36H36FNO6 and a molecular weight of 597.68 g/mol. Its IUPAC name is 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol;2-phenylacetic acid.
| Compound Name | 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol;2-phenylacetic acid |
|---|---|
| PubChem CID | 87055172 |
| Molecular Formula | C36H36FNO6 |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol;2-phenylacetic acid |
| SMILES | CC1=C(c2cccc(O)c2)C(c2ccc(OCCN3CC(CF)C3)cc2)Oc2ccc(O)cc21.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C28H28FNO4.C8H8O2/c1-18-25-14-23(32)7-10-26(25)34-28(27(18)21-3-2-4-22(31)13-21)20-5-8-24(9-6-20)33-12-11-30-16-19(15-29)17-30;9-8(10)6-7-4-2-1-3-5-7/h2-10,13-14,19,28,31-32H,11-12,15-17H2,1H3;1-5H,6H2,(H,9,10) |
| InChIKey | HRAKINHSSUDPAB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|