C28H27ClFNO4 — CID 121423162
(2R)-7-chloro-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 121423162) has the molecular formula C28H27ClFNO4 and a molecular weight of 495.98 g/mol. Its IUPAC name is (2R)-7-chloro-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | (2R)-7-chloro-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 121423162 |
| Molecular Formula | C28H27ClFNO4 |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (2R)-7-chloro-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2cccc(O)c2)[C@@H](c2ccc(OCCN3CC(CF)C3)cc2)Oc2cc(Cl)c(O)cc21 |
| InChI | InChI=1S/C28H27ClFNO4/c1-17-23-12-25(33)24(29)13-26(23)35-28(27(17)20-3-2-4-21(32)11-20)19-5-7-22(8-6-19)34-10-9-31-15-18(14-30)16-31/h2-8,11-13,18,28,32-33H,9-10,14-16H2,1H3/t28-/m1/s1 |
| InChIKey | FSIZQEPXLNUCEQ-MUUNZHRXSA-N |
| XLogP | 6.10 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|