C29H30ClNO4 — CID 121421850
7-chloro-2-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 121421850) has the molecular formula C29H30ClNO4 and a molecular weight of 492.02 g/mol. Its IUPAC name is 7-chloro-2-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | 7-chloro-2-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 121421850 |
| Molecular Formula | C29H30ClNO4 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 7-chloro-2-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CCC1CN(CCOc2ccc(C3Oc4cc(Cl)c(O)cc4C(C)=C3c3cccc(O)c3)cc2)C1 |
| InChI | InChI=1S/C29H30ClNO4/c1-3-19-16-31(17-19)11-12-34-23-9-7-20(8-10-23)29-28(21-5-4-6-22(32)13-21)18(2)24-14-26(33)25(30)15-27(24)35-29/h4-10,13-15,19,29,32-33H,3,11-12,16-17H2,1-2H3 |
| InChIKey | HMZGGTDKMPBYEV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|