C28H26ClF2NO3 — CID 121410073
(2R)-7-chloro-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-fluorophenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 121410073) has the molecular formula C28H26ClF2NO3 and a molecular weight of 497.97 g/mol. Its IUPAC name is (2R)-7-chloro-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-fluorophenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | (2R)-7-chloro-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-fluorophenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 121410073 |
| Molecular Formula | C28H26ClF2NO3 |
| Molecular Weight | 497.97 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (2R)-7-chloro-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-fluorophenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2ccc(F)cc2)[C@@H](c2ccc(OCCN3CC(CF)C3)cc2)Oc2cc(Cl)c(O)cc21 |
| InChI | InChI=1S/C28H26ClF2NO3/c1-17-23-12-25(33)24(29)13-26(23)35-28(27(17)19-2-6-21(31)7-3-19)20-4-8-22(9-5-20)34-11-10-32-15-18(14-30)16-32/h2-9,12-13,18,28,33H,10-11,14-16H2,1H3/t28-/m1/s1 |
| InChIKey | NGWVGEKYBPYCEE-MUUNZHRXSA-N |
| XLogP | 6.53 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.97 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|