C29H29F2NO3 — CID 121410063
2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-fluoro-2-methylphenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 121410063) has the molecular formula C29H29F2NO3 and a molecular weight of 477.55 g/mol. Its IUPAC name is 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-fluoro-2-methylphenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-fluoro-2-methylphenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 121410063 |
| Molecular Formula | C29H29F2NO3 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-fluoro-2-methylphenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2ccc(F)cc2C)C(c2ccc(OCCN3CC(CF)C3)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C29H29F2NO3/c1-18-13-22(31)5-9-25(18)28-19(2)26-14-23(33)6-10-27(26)35-29(28)21-3-7-24(8-4-21)34-12-11-32-16-20(15-30)17-32/h3-10,13-14,20,29,33H,11-12,15-17H2,1-2H3 |
| InChIKey | RBEGUPYVNYYTFY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|