C31H35NO4 — CID 123449703
2-[4-[2-(2,5-dimethylpyrrolidin-1-yl)propoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 123449703) has the molecular formula C31H35NO4 and a molecular weight of 485.62 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dimethylpyrrolidin-1-yl)propoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | 2-[4-[2-(2,5-dimethylpyrrolidin-1-yl)propoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 123449703 |
| Molecular Formula | C31H35NO4 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 2-[4-[2-(2,5-dimethylpyrrolidin-1-yl)propoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2cccc(O)c2)C(c2ccc(OCC(C)N3C(C)CCC3C)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C31H35NO4/c1-19-8-9-20(2)32(19)21(3)18-35-27-13-10-23(11-14-27)31-30(24-6-5-7-25(33)16-24)22(4)28-17-26(34)12-15-29(28)36-31/h5-7,10-17,19-21,31,33-34H,8-9,18H2,1-4H3 |
| InChIKey | VYSNQAPHTGLRRV-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|