C31H34NO5S- — CID 174685835
[4-[6-hydroxy-4-methyl-2-[4-[2-(3-methylpyrrolidin-1-yl)propoxy]phenyl]-2H-chromen-3-yl]phenyl]methanesulfinate (PubChem CID 174685835) has the molecular formula C31H34NO5S- and a molecular weight of 532.68 g/mol. Its IUPAC name is [4-[6-hydroxy-4-methyl-2-[4-[2-(3-methylpyrrolidin-1-yl)propoxy]phenyl]-2H-chromen-3-yl]phenyl]methanesulfinate.
| Compound Name | [4-[6-hydroxy-4-methyl-2-[4-[2-(3-methylpyrrolidin-1-yl)propoxy]phenyl]-2H-chromen-3-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174685835 |
| Molecular Formula | C31H34NO5S- |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | [4-[6-hydroxy-4-methyl-2-[4-[2-(3-methylpyrrolidin-1-yl)propoxy]phenyl]-2H-chromen-3-yl]phenyl]methanesulfinate |
| SMILES | CC1=C(c2ccc(CS(=O)[O-])cc2)C(c2ccc(OCC(C)N3CCC(C)C3)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C31H35NO5S/c1-20-14-15-32(17-20)21(2)18-36-27-11-8-25(9-12-27)31-30(24-6-4-23(5-7-24)19-38(34)35)22(3)28-16-26(33)10-13-29(28)37-31/h4-13,16,20-21,31,33H,14-15,17-19H2,1-3H3,(H,34,35)/p-1 |
| InChIKey | XRCXQWFHIOJHEQ-UHFFFAOYSA-M |
| XLogP | 5.94 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|