C30H30F3NO4 — CID 89496758
3-(4-hydroxyphenyl)-2-[4-[(2S)-2-[(3R)-3-methylpyrrolidin-1-yl]propoxy]phenyl]-4-(trifluoromethyl)-4H-chromen-6-ol (PubChem CID 89496758) has the molecular formula C30H30F3NO4 and a molecular weight of 525.57 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-[4-[(2S)-2-[(3R)-3-methylpyrrolidin-1-yl]propoxy]phenyl]-4-(trifluoromethyl)-4H-chromen-6-ol.
| Compound Name | 3-(4-hydroxyphenyl)-2-[4-[(2S)-2-[(3R)-3-methylpyrrolidin-1-yl]propoxy]phenyl]-4-(trifluoromethyl)-4H-chromen-6-ol |
|---|---|
| PubChem CID | 89496758 |
| Molecular Formula | C30H30F3NO4 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-[4-[(2S)-2-[(3R)-3-methylpyrrolidin-1-yl]propoxy]phenyl]-4-(trifluoromethyl)-4H-chromen-6-ol |
| SMILES | C[C@@H]1CCN([C@@H](C)COc2ccc(C3=C(c4ccc(O)cc4)C(C(F)(F)F)c4cc(O)ccc4O3)cc2)C1 |
| InChI | InChI=1S/C30H30F3NO4/c1-18-13-14-34(16-18)19(2)17-37-24-10-5-21(6-11-24)29-27(20-3-7-22(35)8-4-20)28(30(31,32)33)25-15-23(36)9-12-26(25)38-29/h3-12,15,18-19,28,35-36H,13-14,16-17H2,1-2H3/t18-,19+,28?/m1/s1 |
| InChIKey | FEYMFRZEWFBIQA-ZUDGUFDASA-N |
| XLogP | 6.81 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|