C23H27NO2 — CID 123754108
(3R)-1-[(2S)-1-[4-(2H-chromen-2-yl)phenoxy]propan-2-yl]-3-methylpyrrolidine (PubChem CID 123754108) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is (3R)-1-[(2S)-1-[4-(2H-chromen-2-yl)phenoxy]propan-2-yl]-3-methylpyrrolidine.
| Compound Name | (3R)-1-[(2S)-1-[4-(2H-chromen-2-yl)phenoxy]propan-2-yl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 123754108 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (3R)-1-[(2S)-1-[4-(2H-chromen-2-yl)phenoxy]propan-2-yl]-3-methylpyrrolidine |
| SMILES | C[C@@H]1CCN([C@@H](C)COc2ccc(C3C=Cc4ccccc4O3)cc2)C1 |
| InChI | InChI=1S/C23H27NO2/c1-17-13-14-24(15-17)18(2)16-25-21-10-7-20(8-11-21)23-12-9-19-5-3-4-6-22(19)26-23/h3-12,17-18,23H,13-16H2,1-2H3/t17-,18+,23?/m1/s1 |
| InChIKey | YXWCSUCSJDAGND-BATLZEKGSA-N |
| XLogP | 4.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |