C31H35NO3 — CID 123697708
(3S)-1-[(2R)-1-[4-[5-methoxy-2-(3-methoxyphenyl)-3H-inden-1-yl]phenoxy]propan-2-yl]-3-methylpyrrolidine (PubChem CID 123697708) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is (3S)-1-[(2R)-1-[4-[5-methoxy-2-(3-methoxyphenyl)-3H-inden-1-yl]phenoxy]propan-2-yl]-3-methylpyrrolidine.
| Compound Name | (3S)-1-[(2R)-1-[4-[5-methoxy-2-(3-methoxyphenyl)-3H-inden-1-yl]phenoxy]propan-2-yl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 123697708 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | (3S)-1-[(2R)-1-[4-[5-methoxy-2-(3-methoxyphenyl)-3H-inden-1-yl]phenoxy]propan-2-yl]-3-methylpyrrolidine |
| SMILES | COc1cccc(C2=C(c3ccc(OC[C@@H](C)N4CC[C@H](C)C4)cc3)c3ccc(OC)cc3C2)c1 |
| InChI | InChI=1S/C31H35NO3/c1-21-14-15-32(19-21)22(2)20-35-26-10-8-23(9-11-26)31-29-13-12-28(34-4)17-25(29)18-30(31)24-6-5-7-27(16-24)33-3/h5-13,16-17,21-22H,14-15,18-20H2,1-4H3/t21-,22+/m0/s1 |
| InChIKey | OROTUZSVKLAJEM-FCHUYYIVSA-N |
| XLogP | 6.33 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|