C29H33NO3 — CID 10718119
N,N-diethyl-2-[4-[6-methoxy-3-(4-methoxyphenyl)-1H-inden-2-yl]phenoxy]ethanamine (PubChem CID 10718119) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[6-methoxy-3-(4-methoxyphenyl)-1H-inden-2-yl]phenoxy]ethanamine.
| Compound Name | N,N-diethyl-2-[4-[6-methoxy-3-(4-methoxyphenyl)-1H-inden-2-yl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 10718119 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N,N-diethyl-2-[4-[6-methoxy-3-(4-methoxyphenyl)-1H-inden-2-yl]phenoxy]ethanamine |
| SMILES | CCN(CC)CCOc1ccc(C2=C(c3ccc(OC)cc3)c3ccc(OC)cc3C2)cc1 |
| InChI | InChI=1S/C29H33NO3/c1-5-30(6-2)17-18-33-25-13-7-21(8-14-25)28-20-23-19-26(32-4)15-16-27(23)29(28)22-9-11-24(31-3)12-10-22/h7-16,19H,5-6,17-18,20H2,1-4H3 |
| InChIKey | DIZHXTPYGXPZOW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|