C30H34ClNO2 — CID 24845439
1-[2-[4-(5-methoxy-2-phenyl-3H-inden-1-yl)phenoxy]ethyl]-2,2-dimethylpyrrolidine;hydrochloride (PubChem CID 24845439) has the molecular formula C30H34ClNO2 and a molecular weight of 476.06 g/mol. Its IUPAC name is 1-[2-[4-(5-methoxy-2-phenyl-3H-inden-1-yl)phenoxy]ethyl]-2,2-dimethylpyrrolidine;hydrochloride.
| Compound Name | 1-[2-[4-(5-methoxy-2-phenyl-3H-inden-1-yl)phenoxy]ethyl]-2,2-dimethylpyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 24845439 |
| Molecular Formula | C30H34ClNO2 |
| Molecular Weight | 476.06 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-[2-[4-(5-methoxy-2-phenyl-3H-inden-1-yl)phenoxy]ethyl]-2,2-dimethylpyrrolidine;hydrochloride |
| SMILES | COc1ccc2c(c1)CC(c1ccccc1)=C2c1ccc(OCCN2CCCC2(C)C)cc1.Cl |
| InChI | InChI=1S/C30H33NO2.ClH/c1-30(2)16-7-17-31(30)18-19-33-25-12-10-23(11-13-25)29-27-15-14-26(32-3)20-24(27)21-28(29)22-8-5-4-6-9-22;/h4-6,8-15,20H,7,16-19,21H2,1-3H3;1H |
| InChIKey | DPZNIXHCJSFUQS-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.06 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|