C30H34ClNO3 — CID 3069186
1-[2-[3-(7-methoxy-2,2-dimethyl-3-phenylchromen-4-yl)phenoxy]ethyl]pyrrolidine;hydrochloride (PubChem CID 3069186) has the molecular formula C30H34ClNO3 and a molecular weight of 492.06 g/mol. Its IUPAC name is 1-[2-[3-(7-methoxy-2,2-dimethyl-3-phenylchromen-4-yl)phenoxy]ethyl]pyrrolidine;hydrochloride.
| Compound Name | 1-[2-[3-(7-methoxy-2,2-dimethyl-3-phenylchromen-4-yl)phenoxy]ethyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 3069186 |
| Molecular Formula | C30H34ClNO3 |
| Molecular Weight | 492.06 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 1-[2-[3-(7-methoxy-2,2-dimethyl-3-phenylchromen-4-yl)phenoxy]ethyl]pyrrolidine;hydrochloride |
| SMILES | COc1ccc2c(c1)OC(C)(C)C(c1ccccc1)=C2c1cccc(OCCN2CCCC2)c1.Cl |
| InChI | InChI=1S/C30H33NO3.ClH/c1-30(2)29(22-10-5-4-6-11-22)28(26-15-14-24(32-3)21-27(26)34-30)23-12-9-13-25(20-23)33-19-18-31-16-7-8-17-31;/h4-6,9-15,20-21H,7-8,16-19H2,1-3H3;1H |
| InChIKey | GZSQPAVCWRNXME-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.06 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|