C22H32ClNO — CID 11617475
1-[4-(6-methoxynaphthalen-1-yl)butyl]-2,2-dimethylpiperidine;hydrochloride (PubChem CID 11617475) has the molecular formula C22H32ClNO and a molecular weight of 361.96 g/mol. Its IUPAC name is 1-[4-(6-methoxynaphthalen-1-yl)butyl]-2,2-dimethylpiperidine;hydrochloride.
| Compound Name | 1-[4-(6-methoxynaphthalen-1-yl)butyl]-2,2-dimethylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 11617475 |
| Molecular Formula | C22H32ClNO |
| Molecular Weight | 361.96 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[4-(6-methoxynaphthalen-1-yl)butyl]-2,2-dimethylpiperidine;hydrochloride |
| SMILES | COc1ccc2c(CCCCN3CCCCC3(C)C)cccc2c1.Cl |
| InChI | InChI=1S/C22H31NO.ClH/c1-22(2)14-5-7-16-23(22)15-6-4-9-18-10-8-11-19-17-20(24-3)12-13-21(18)19;/h8,10-13,17H,4-7,9,14-16H2,1-3H3;1H |
| InChIKey | OUYFLHNTFAPYSW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.96 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|