C14H15BrO — CID 11514645
1-(3-bromopropyl)-6-methoxynaphthalene (PubChem CID 11514645) has the molecular formula C14H15BrO and a molecular weight of 279.18 g/mol. Its IUPAC name is 1-(3-bromopropyl)-6-methoxynaphthalene.
| Compound Name | 1-(3-bromopropyl)-6-methoxynaphthalene |
|---|---|
| PubChem CID | 11514645 |
| Molecular Formula | C14H15BrO |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-(3-bromopropyl)-6-methoxynaphthalene |
| SMILES | COc1ccc2c(CCCBr)cccc2c1 |
| InChI | InChI=1S/C14H15BrO/c1-16-13-7-8-14-11(6-3-9-15)4-2-5-12(14)10-13/h2,4-5,7-8,10H,3,6,9H2,1H3 |
| InChIKey | DZEUMQOGSIFRNB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|