C20H26FNO — CID 135033356
3-(18F)fluoro-1-[3-(6-methoxynaphthalen-1-yl)propyl]-3-methylpiperidine (PubChem CID 135033356) has the molecular formula C20H26FNO and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-(18F)fluoro-1-[3-(6-methoxynaphthalen-1-yl)propyl]-3-methylpiperidine.
| Compound Name | 3-(18F)fluoro-1-[3-(6-methoxynaphthalen-1-yl)propyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 135033356 |
| Molecular Formula | C20H26FNO |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-(18F)fluoro-1-[3-(6-methoxynaphthalen-1-yl)propyl]-3-methylpiperidine |
| SMILES | COc1ccc2c(CCCN3CCCC(C)([18F])C3)cccc2c1 |
| InChI | InChI=1S/C20H26FNO/c1-20(21)11-5-13-22(15-20)12-4-8-16-6-3-7-17-14-18(23-2)9-10-19(16)17/h3,6-7,9-10,14H,4-5,8,11-13,15H2,1-2H3/i21-1 |
| InChIKey | ZTJCSBLMALKBJX-GJQNQZCXSA-N |
| XLogP | 4.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |