C14H18BrF2NO — CID 171934527
1-[2-(2-bromo-5-methoxyphenyl)ethyl]-3,3-difluoropiperidine (PubChem CID 171934527) has the molecular formula C14H18BrF2NO and a molecular weight of 334.20 g/mol. Its IUPAC name is 1-[2-(2-bromo-5-methoxyphenyl)ethyl]-3,3-difluoropiperidine.
| Compound Name | 1-[2-(2-bromo-5-methoxyphenyl)ethyl]-3,3-difluoropiperidine |
|---|---|
| PubChem CID | 171934527 |
| Molecular Formula | C14H18BrF2NO |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-[2-(2-bromo-5-methoxyphenyl)ethyl]-3,3-difluoropiperidine |
| SMILES | COc1ccc(Br)c(CCN2CCCC(F)(F)C2)c1 |
| InChI | InChI=1S/C14H18BrF2NO/c1-19-12-3-4-13(15)11(9-12)5-8-18-7-2-6-14(16,17)10-18/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | YNXSSTRYQGVFBG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |