C15H23BrN2O2 — CID 65327008
2-[4-[(2-bromo-5-methoxyphenyl)methyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 65327008) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.26 g/mol. Its IUPAC name is 2-[4-[(2-bromo-5-methoxyphenyl)methyl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[(2-bromo-5-methoxyphenyl)methyl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 65327008 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[4-[(2-bromo-5-methoxyphenyl)methyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | COc1ccc(Br)c(CN2CCCN(CCO)CC2)c1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-20-14-3-4-15(16)13(11-14)12-18-6-2-5-17(7-8-18)9-10-19/h3-4,11,19H,2,5-10,12H2,1H3 |
| InChIKey | TZLUGDHEUNZNKE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |