C14H20BrNO2 — CID 65326119
4-[(2-bromo-5-methoxyphenyl)methyl]-2-methyl-1,4-oxazepane (PubChem CID 65326119) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is 4-[(2-bromo-5-methoxyphenyl)methyl]-2-methyl-1,4-oxazepane.
| Compound Name | 4-[(2-bromo-5-methoxyphenyl)methyl]-2-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 65326119 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-[(2-bromo-5-methoxyphenyl)methyl]-2-methyl-1,4-oxazepane |
| SMILES | COc1ccc(Br)c(CN2CCCOC(C)C2)c1 |
| InChI | InChI=1S/C14H20BrNO2/c1-11-9-16(6-3-7-18-11)10-12-8-13(17-2)4-5-14(12)15/h4-5,8,11H,3,6-7,9-10H2,1-2H3 |
| InChIKey | BJDJPUIGZRJCGL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |