C22H35BrN2O2 — CID 23029899
2-[4-[2-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]ethyl]piperidin-1-yl]ethanol (PubChem CID 23029899) has the molecular formula C22H35BrN2O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is 2-[4-[2-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]ethyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[2-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]ethyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 23029899 |
| Molecular Formula | C22H35BrN2O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[4-[2-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]ethyl]piperidin-1-yl]ethanol |
| SMILES | COc1ccc(Br)c(CC2CCN(CCC3CCN(CCO)CC3)CC2)c1 |
| InChI | InChI=1S/C22H35BrN2O2/c1-27-21-2-3-22(23)20(17-21)16-19-7-12-24(13-8-19)9-4-18-5-10-25(11-6-18)14-15-26/h2-3,17-19,26H,4-16H2,1H3 |
| InChIKey | MLTBFFMMRBAJHW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |