C25H39BrN2O2 — CID 23029894
N-[4-[3-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]propyl]cyclohexyl]propanamide (PubChem CID 23029894) has the molecular formula C25H39BrN2O2 and a molecular weight of 479.50 g/mol. Its IUPAC name is N-[4-[3-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]propyl]cyclohexyl]propanamide.
| Compound Name | N-[4-[3-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]propyl]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 23029894 |
| Molecular Formula | C25H39BrN2O2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[4-[3-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]propyl]cyclohexyl]propanamide |
| SMILES | CCC(=O)NC1CCC(CCCN2CCC(Cc3cc(OC)ccc3Br)CC2)CC1 |
| InChI | InChI=1S/C25H39BrN2O2/c1-3-25(29)27-22-8-6-19(7-9-22)5-4-14-28-15-12-20(13-16-28)17-21-18-23(30-2)10-11-24(21)26/h10-11,18-20,22H,3-9,12-17H2,1-2H3,(H,27,29) |
| InChIKey | NKWLYBDDTDLKHN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |