C21H32BrN3O2 — CID 23030147
4-[3-[3-[(2-bromo-5-methoxyphenyl)methyl]pyrrolidin-1-yl]propyl]piperidine-1-carboxamide (PubChem CID 23030147) has the molecular formula C21H32BrN3O2 and a molecular weight of 438.41 g/mol. Its IUPAC name is 4-[3-[3-[(2-bromo-5-methoxyphenyl)methyl]pyrrolidin-1-yl]propyl]piperidine-1-carboxamide.
| Compound Name | 4-[3-[3-[(2-bromo-5-methoxyphenyl)methyl]pyrrolidin-1-yl]propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 23030147 |
| Molecular Formula | C21H32BrN3O2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 4-[3-[3-[(2-bromo-5-methoxyphenyl)methyl]pyrrolidin-1-yl]propyl]piperidine-1-carboxamide |
| SMILES | COc1ccc(Br)c(CC2CCN(CCCC3CCN(C(N)=O)CC3)C2)c1 |
| InChI | InChI=1S/C21H32BrN3O2/c1-27-19-4-5-20(22)18(14-19)13-17-6-10-24(15-17)9-2-3-16-7-11-25(12-8-16)21(23)26/h4-5,14,16-17H,2-3,6-13,15H2,1H3,(H2,23,26) |
| InChIKey | CBVVQXKFMZGVKG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |