C21H33BrN4O — CID 23030012
3-[3-[3-[(2-bromo-5-methoxyphenyl)methyl]pyrrolidin-1-yl]propyl]piperidine-1-carboximidamide (PubChem CID 23030012) has the molecular formula C21H33BrN4O and a molecular weight of 437.43 g/mol. Its IUPAC name is 3-[3-[3-[(2-bromo-5-methoxyphenyl)methyl]pyrrolidin-1-yl]propyl]piperidine-1-carboximidamide.
| Compound Name | 3-[3-[3-[(2-bromo-5-methoxyphenyl)methyl]pyrrolidin-1-yl]propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 23030012 |
| Molecular Formula | C21H33BrN4O |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 3-[3-[3-[(2-bromo-5-methoxyphenyl)methyl]pyrrolidin-1-yl]propyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC(CCCN2CCC(Cc3cc(OC)ccc3Br)C2)C1 |
| InChI | InChI=1S/C21H33BrN4O/c1-27-19-6-7-20(22)18(13-19)12-17-8-11-25(14-17)9-2-4-16-5-3-10-26(15-16)21(23)24/h6-7,13,16-17H,2-5,8-12,14-15H2,1H3,(H3,23,24) |
| InChIKey | XAPKJAHKIIZJAH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|