C22H36BrN3O3S — CID 23029213
4-[(2-bromo-5-methoxyphenyl)methyl]-1-[3-[4-(sulfamoylamino)cyclohexyl]propyl]piperidine (PubChem CID 23029213) has the molecular formula C22H36BrN3O3S and a molecular weight of 502.52 g/mol. Its IUPAC name is 4-[(2-bromo-5-methoxyphenyl)methyl]-1-[3-[4-(sulfamoylamino)cyclohexyl]propyl]piperidine.
| Compound Name | 4-[(2-bromo-5-methoxyphenyl)methyl]-1-[3-[4-(sulfamoylamino)cyclohexyl]propyl]piperidine |
|---|---|
| PubChem CID | 23029213 |
| Molecular Formula | C22H36BrN3O3S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 4-[(2-bromo-5-methoxyphenyl)methyl]-1-[3-[4-(sulfamoylamino)cyclohexyl]propyl]piperidine |
| SMILES | COc1ccc(Br)c(CC2CCN(CCCC3CCC(NS(N)(=O)=O)CC3)CC2)c1 |
| InChI | InChI=1S/C22H36BrN3O3S/c1-29-21-8-9-22(23)19(16-21)15-18-10-13-26(14-11-18)12-2-3-17-4-6-20(7-5-17)25-30(24,27)28/h8-9,16-18,20,25H,2-7,10-15H2,1H3,(H2,24,27,28) |
| InChIKey | JDNYPYUREIBOLS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |