C20H31BrFN3O2S — CID 23029499
4-[(2-bromo-5-fluorophenyl)methyl]-1-[2-[4-(sulfamoylamino)cyclohexyl]ethyl]piperidine (PubChem CID 23029499) has the molecular formula C20H31BrFN3O2S and a molecular weight of 476.46 g/mol. Its IUPAC name is 4-[(2-bromo-5-fluorophenyl)methyl]-1-[2-[4-(sulfamoylamino)cyclohexyl]ethyl]piperidine.
| Compound Name | 4-[(2-bromo-5-fluorophenyl)methyl]-1-[2-[4-(sulfamoylamino)cyclohexyl]ethyl]piperidine |
|---|---|
| PubChem CID | 23029499 |
| Molecular Formula | C20H31BrFN3O2S |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 4-[(2-bromo-5-fluorophenyl)methyl]-1-[2-[4-(sulfamoylamino)cyclohexyl]ethyl]piperidine |
| SMILES | NS(=O)(=O)NC1CCC(CCN2CCC(Cc3cc(F)ccc3Br)CC2)CC1 |
| InChI | InChI=1S/C20H31BrFN3O2S/c21-20-6-3-18(22)14-17(20)13-16-8-11-25(12-9-16)10-7-15-1-4-19(5-2-15)24-28(23,26)27/h3,6,14-16,19,24H,1-2,4-5,7-13H2,(H2,23,26,27) |
| InChIKey | WYYNSOVJYMOCCG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |