C32H37NO4 — CID 12017123
[6-methoxy-2-(4-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanol (PubChem CID 12017123) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is [6-methoxy-2-(4-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanol.
| Compound Name | [6-methoxy-2-(4-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 12017123 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | [6-methoxy-2-(4-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanol |
| SMILES | COc1ccc(C2=C(C(O)c3ccc(OCCN4CCCCC4)cc3)c3ccc(OC)cc3CC2)cc1 |
| InChI | InChI=1S/C32H37NO4/c1-35-26-11-6-23(7-12-26)29-16-10-25-22-28(36-2)15-17-30(25)31(29)32(34)24-8-13-27(14-9-24)37-21-20-33-18-4-3-5-19-33/h6-9,11-15,17,22,32,34H,3-5,10,16,18-21H2,1-2H3 |
| InChIKey | YLRGPEUOAWPUSY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|