C32H36ClNO4 — CID 18182621
[2-(3-chloro-4-methoxyphenyl)-6-methoxy-3,4-dihydronaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanol (PubChem CID 18182621) has the molecular formula C32H36ClNO4 and a molecular weight of 534.10 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyphenyl)-6-methoxy-3,4-dihydronaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanol.
| Compound Name | [2-(3-chloro-4-methoxyphenyl)-6-methoxy-3,4-dihydronaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 18182621 |
| Molecular Formula | C32H36ClNO4 |
| Molecular Weight | 534.10 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | [2-(3-chloro-4-methoxyphenyl)-6-methoxy-3,4-dihydronaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanol |
| SMILES | COc1ccc2c(c1)CCC(c1ccc(OC)c(Cl)c1)=C2C(O)c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C32H36ClNO4/c1-36-26-12-14-28-23(20-26)8-13-27(24-9-15-30(37-2)29(33)21-24)31(28)32(35)22-6-10-25(11-7-22)38-19-18-34-16-4-3-5-17-34/h6-7,9-12,14-15,20-21,32,35H,3-5,8,13,16-19H2,1-2H3 |
| InChIKey | WSFNZLKXSBZEQR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.10 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|