C12H14Br2O3 — CID 125483390
(2S)-2-(2,6-dibromo-4-methoxyphenoxy)oxane (PubChem CID 125483390) has the molecular formula C12H14Br2O3 and a molecular weight of 366.05 g/mol. Its IUPAC name is (2S)-2-(2,6-dibromo-4-methoxyphenoxy)oxane.
| Compound Name | (2S)-2-(2,6-dibromo-4-methoxyphenoxy)oxane |
|---|---|
| PubChem CID | 125483390 |
| Molecular Formula | C12H14Br2O3 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | (2S)-2-(2,6-dibromo-4-methoxyphenoxy)oxane |
| SMILES | COc1cc(Br)c(O[C@H]2CCCCO2)c(Br)c1 |
| InChI | InChI=1S/C12H14Br2O3/c1-15-8-6-9(13)12(10(14)7-8)17-11-4-2-3-5-16-11/h6-7,11H,2-5H2,1H3/t11-/m0/s1 |
| InChIKey | QEYJDGKGAFFXGS-NSHDSACASA-N |
| XLogP | 4.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |