C33H29F3O8S — CID 10675649
[3-[9-(methoxymethoxy)-3-methyl-3-(4-methylpent-3-enyl)benzo[f]chromen-8-yl]-1,4-dioxonaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 10675649) has the molecular formula C33H29F3O8S and a molecular weight of 642.65 g/mol. Its IUPAC name is [3-[9-(methoxymethoxy)-3-methyl-3-(4-methylpent-3-enyl)benzo[f]chromen-8-yl]-1,4-dioxonaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [3-[9-(methoxymethoxy)-3-methyl-3-(4-methylpent-3-enyl)benzo[f]chromen-8-yl]-1,4-dioxonaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10675649 |
| Molecular Formula | C33H29F3O8S |
| Molecular Weight | 642.65 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | [3-[9-(methoxymethoxy)-3-methyl-3-(4-methylpent-3-enyl)benzo[f]chromen-8-yl]-1,4-dioxonaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | COCOc1cc2c3c(ccc2cc1C1=C(OS(=O)(=O)C(F)(F)F)C(=O)c2ccccc2C1=O)OC(C)(CCC=C(C)C)C=C3 |
| InChI | InChI=1S/C33H29F3O8S/c1-19(2)8-7-14-32(3)15-13-21-24-17-27(42-18-41-4)25(16-20(24)11-12-26(21)43-32)28-29(37)22-9-5-6-10-23(22)30(38)31(28)44-45(39,40)33(34,35)36/h5-6,8-13,15-17H,7,14,18H2,1-4H3 |
| InChIKey | WXQFYWSKLIPJJS-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.65 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|