C23H21F3O6S — CID 59590478
ethyl 7-[(2,6-dimethylphenyl)methoxy]-4-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate (PubChem CID 59590478) has the molecular formula C23H21F3O6S and a molecular weight of 482.48 g/mol. Its IUPAC name is ethyl 7-[(2,6-dimethylphenyl)methoxy]-4-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate.
| Compound Name | ethyl 7-[(2,6-dimethylphenyl)methoxy]-4-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59590478 |
| Molecular Formula | C23H21F3O6S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | ethyl 7-[(2,6-dimethylphenyl)methoxy]-4-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(OS(=O)(=O)C(F)(F)F)c2ccc(OCc3c(C)cccc3C)cc2c1 |
| InChI | InChI=1S/C23H21F3O6S/c1-4-30-22(27)17-10-16-11-18(31-13-20-14(2)6-5-7-15(20)3)8-9-19(16)21(12-17)32-33(28,29)23(24,25)26/h5-12H,4,13H2,1-3H3 |
| InChIKey | UFJVIJXNNRSLSO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|