C20H26O4 — CID 139310392
2-but-3-enyl-5-hydroxy-2-methyl-7-pentylchromene-6-carboxylic acid (PubChem CID 139310392) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-but-3-enyl-5-hydroxy-2-methyl-7-pentylchromene-6-carboxylic acid.
| Compound Name | 2-but-3-enyl-5-hydroxy-2-methyl-7-pentylchromene-6-carboxylic acid |
|---|---|
| PubChem CID | 139310392 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-but-3-enyl-5-hydroxy-2-methyl-7-pentylchromene-6-carboxylic acid |
| SMILES | C=CCCC1(C)C=Cc2c(cc(CCCCC)c(C(=O)O)c2O)O1 |
| InChI | InChI=1S/C20H26O4/c1-4-6-8-9-14-13-16-15(18(21)17(14)19(22)23)10-12-20(3,24-16)11-7-5-2/h5,10,12-13,21H,2,4,6-9,11H2,1,3H3,(H,22,23) |
| InChIKey | CXSQJEQMWDYQRJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|