C28H42O — CID 175738144
2,4,8-trimethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromene (PubChem CID 175738144) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is 2,4,8-trimethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromene.
| Compound Name | 2,4,8-trimethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromene |
|---|---|
| PubChem CID | 175738144 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | 2,4,8-trimethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC1(C)CC(C)c2cccc(C)c2O1 |
| InChI | InChI=1S/C28H42O/c1-21(2)12-8-13-22(3)14-9-15-23(4)16-11-19-28(7)20-25(6)26-18-10-17-24(5)27(26)29-28/h10,12,14,16-18,25H,8-9,11,13,15,19-20H2,1-7H3 |
| InChIKey | YPMQCVNSJYKNPN-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|