C21H29NO2 — CID 163153776
3-(3,7-dimethylocta-2,6-dienyl)-4-methoxy-2-methyl-1-oxido-1,2-dihydroquinolin-1-ium (PubChem CID 163153776) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-(3,7-dimethylocta-2,6-dienyl)-4-methoxy-2-methyl-1-oxido-1,2-dihydroquinolin-1-ium.
| Compound Name | 3-(3,7-dimethylocta-2,6-dienyl)-4-methoxy-2-methyl-1-oxido-1,2-dihydroquinolin-1-ium |
|---|---|
| PubChem CID | 163153776 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 3-(3,7-dimethylocta-2,6-dienyl)-4-methoxy-2-methyl-1-oxido-1,2-dihydroquinolin-1-ium |
| SMILES | COC1=C(CC=C(C)CCC=C(C)C)C(C)[NH+]([O-])c2ccccc21 |
| InChI | InChI=1S/C21H29NO2/c1-15(2)9-8-10-16(3)13-14-18-17(4)22(23)20-12-7-6-11-19(20)21(18)24-5/h6-7,9,11-13,17,22H,8,10,14H2,1-5H3 |
| InChIKey | OIOVJYGLHUSOPE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 36.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|