C26H42O2 — CID 11234568
2,8-dimethyl-2-(4,8,11-trimethyldodecyl)chromen-6-ol (PubChem CID 11234568) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 2,8-dimethyl-2-(4,8,11-trimethyldodecyl)chromen-6-ol.
| Compound Name | 2,8-dimethyl-2-(4,8,11-trimethyldodecyl)chromen-6-ol |
|---|---|
| PubChem CID | 11234568 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 2,8-dimethyl-2-(4,8,11-trimethyldodecyl)chromen-6-ol |
| SMILES | Cc1cc(O)cc2c1OC(C)(CCCC(C)CCCC(C)CCC(C)C)C=C2 |
| InChI | InChI=1S/C26H42O2/c1-19(2)12-13-21(4)10-7-9-20(3)11-8-15-26(6)16-14-23-18-24(27)17-22(5)25(23)28-26/h14,16-21,27H,7-13,15H2,1-6H3 |
| InChIKey | JFDNCZUQTPEGMC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |