C33H48O3 — CID 171379932
[2,5-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]benzo[h]chromen-6-yl] acetate (PubChem CID 171379932) has the molecular formula C33H48O3 and a molecular weight of 492.74 g/mol. Its IUPAC name is [2,5-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]benzo[h]chromen-6-yl] acetate.
| Compound Name | [2,5-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]benzo[h]chromen-6-yl] acetate |
|---|---|
| PubChem CID | 171379932 |
| Molecular Formula | C33H48O3 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | [2,5-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]benzo[h]chromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c2c(c3ccccc13)OC(C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C=C2 |
| InChI | InChI=1S/C33H48O3/c1-23(2)13-10-14-24(3)15-11-16-25(4)17-12-21-33(7)22-20-28-26(5)31(35-27(6)34)29-18-8-9-19-30(29)32(28)36-33/h8-9,18-20,22-25H,10-17,21H2,1-7H3/t24-,25-,33?/m1/s1 |
| InChIKey | UGEVPMJGYLJABX-AAKKKFBHSA-N |
| XLogP | 9.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|