C28H46O2 — CID 146501230
(2R)-2,5,7-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chromen-6-ol (PubChem CID 146501230) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is (2R)-2,5,7-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chromen-6-ol.
| Compound Name | (2R)-2,5,7-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chromen-6-ol |
|---|---|
| PubChem CID | 146501230 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | (2R)-2,5,7-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chromen-6-ol |
| SMILES | Cc1cc2c(c(C)c1O)C=C[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C28H46O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-24(6)27(29)23(5)19-26(25)30-28/h16,18-22,29H,8-15,17H2,1-7H3/t21-,22-,28-/m1/s1 |
| InChIKey | KSMATCRYYPLXOM-DQCZWYHMSA-N |
| XLogP | 8.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |